C15H19F2N3 — CID 115526450
N-[[3-(difluoromethyl)phenyl]methyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine (PubChem CID 115526450) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 115526450 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-3-(5-methyl-1H-pyrazol-4-yl)propan-1-amine |
| SMILES | Cc1[nH]ncc1CCCNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C15H19F2N3/c1-11-14(10-19-20-11)6-3-7-18-9-12-4-2-5-13(8-12)15(16)17/h2,4-5,8,10,15,18H,3,6-7,9H2,1H3,(H,19,20) |
| InChIKey | LBIUHQTTYVVWLU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|