C17H18F3N — CID 115526630
N-[[3-(difluoromethyl)phenyl]methyl]-2-(4-fluoro-2-methylphenyl)ethanamine (PubChem CID 115526630) has the molecular formula C17H18F3N and a molecular weight of 293.33 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2-(4-fluoro-2-methylphenyl)ethanamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-(4-fluoro-2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 115526630 |
| Molecular Formula | C17H18F3N |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-(4-fluoro-2-methylphenyl)ethanamine |
| SMILES | Cc1cc(F)ccc1CCNCc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C17H18F3N/c1-12-9-16(18)6-5-14(12)7-8-21-11-13-3-2-4-15(10-13)17(19)20/h2-6,9-10,17,21H,7-8,11H2,1H3 |
| InChIKey | IAGJIOIFPLHKLN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|