C14H15F2NS — CID 115526406
N-[[3-(difluoromethyl)phenyl]methyl]-2-thiophen-3-ylethanamine (PubChem CID 115526406) has the molecular formula C14H15F2NS and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 115526406 |
| Molecular Formula | C14H15F2NS |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-thiophen-3-ylethanamine |
| SMILES | FC(F)c1cccc(CNCCc2ccsc2)c1 |
| InChI | InChI=1S/C14H15F2NS/c15-14(16)13-3-1-2-12(8-13)9-17-6-4-11-5-7-18-10-11/h1-3,5,7-8,10,14,17H,4,6,9H2 |
| InChIKey | PGNJBYLKMLQMEE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|