C19H19NS — CID 63455136
N-[(4-phenylphenyl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 63455136) has the molecular formula C19H19NS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-[(4-phenylphenyl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(4-phenylphenyl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 63455136 |
| Molecular Formula | C19H19NS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-[(4-phenylphenyl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | c1ccc(-c2ccc(CNCCc3ccsc3)cc2)cc1 |
| InChI | InChI=1S/C19H19NS/c1-2-4-18(5-3-1)19-8-6-16(7-9-19)14-20-12-10-17-11-13-21-15-17/h1-9,11,13,15,20H,10,12,14H2 |
| InChIKey | MUHQDWGOVRHQNA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|