C12H16N2S — CID 62132424
N-[(1-methylpyrrol-2-yl)methyl]-2-thiophen-3-ylethanamine (PubChem CID 62132424) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 62132424 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-2-thiophen-3-ylethanamine |
| SMILES | Cn1cccc1CNCCc1ccsc1 |
| InChI | InChI=1S/C12H16N2S/c1-14-7-2-3-12(14)9-13-6-4-11-5-8-15-10-11/h2-3,5,7-8,10,13H,4,6,9H2,1H3 |
| InChIKey | ZKAJXPMIKDKIOT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|