C12H17N3S — CID 115641746
N-[(1-methylpyrrol-2-yl)methyl]-2-(5-methyl-1,3-thiazol-2-yl)ethanamine (PubChem CID 115641746) has the molecular formula C12H17N3S and a molecular weight of 235.36 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-2-(5-methyl-1,3-thiazol-2-yl)ethanamine.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-2-(5-methyl-1,3-thiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 115641746 |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-2-(5-methyl-1,3-thiazol-2-yl)ethanamine |
| SMILES | Cc1cnc(CCNCc2cccn2C)s1 |
| InChI | InChI=1S/C12H17N3S/c1-10-8-14-12(16-10)5-6-13-9-11-4-3-7-15(11)2/h3-4,7-8,13H,5-6,9H2,1-2H3 |
| InChIKey | CLYLNERITGOHMZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|