C9H17ClN2 — CID 17293409
N-[(1-methylpyrrol-2-yl)methyl]propan-1-amine;hydrochloride (PubChem CID 17293409) has the molecular formula C9H17ClN2 and a molecular weight of 188.70 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17293409 |
| Molecular Formula | C9H17ClN2 |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1cccn1C.Cl |
| InChI | InChI=1S/C9H16N2.ClH/c1-3-6-10-8-9-5-4-7-11(9)2;/h4-5,7,10H,3,6,8H2,1-2H3;1H |
| InChIKey | KRLNYHMDBQJRLV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|