C9H16N2O — CID 28876885
3-[(1-methylpyrrol-2-yl)methylamino]propan-1-ol (PubChem CID 28876885) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(1-methylpyrrol-2-yl)methylamino]propan-1-ol.
| Compound Name | 3-[(1-methylpyrrol-2-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 28876885 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-[(1-methylpyrrol-2-yl)methylamino]propan-1-ol |
| SMILES | Cn1cccc1CNCCCO |
| InChI | InChI=1S/C9H16N2O/c1-11-6-2-4-9(11)8-10-5-3-7-12/h2,4,6,10,12H,3,5,7-8H2,1H3 |
| InChIKey | RRZBIJGUVSZYCT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|