C11H16N2S — CID 115642858
N-[(1-methylpyrrol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 115642858) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is N-[(1-methylpyrrol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(1-methylpyrrol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 115642858 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | N-[(1-methylpyrrol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1cccn1C |
| InChI | InChI=1S/C11H16N2S/c1-3-8-14-9-6-12-10-11-5-4-7-13(11)2/h1,4-5,7,12H,6,8-10H2,2H3 |
| InChIKey | VKXAOYJRKJQBJJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|