C12H19N3S — CID 106426205
N-[(1-propylimidazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 106426205) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N-[(1-propylimidazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(1-propylimidazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 106426205 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-[(1-propylimidazol-2-yl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1nccn1CCC |
| InChI | InChI=1S/C12H19N3S/c1-3-7-15-8-5-14-12(15)11-13-6-10-16-9-4-2/h2,5,8,13H,3,6-7,9-11H2,1H3 |
| InChIKey | CWCPRIPGFDTLHF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|