C9H18N4 — CID 62957721
N'-[(1-propylimidazol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62957721) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is N'-[(1-propylimidazol-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(1-propylimidazol-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62957721 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | N'-[(1-propylimidazol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CCCn1ccnc1CNCCN |
| InChI | InChI=1S/C9H18N4/c1-2-6-13-7-5-12-9(13)8-11-4-3-10/h5,7,11H,2-4,6,8,10H2,1H3 |
| InChIKey | JYAMQZFMJYENPE-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|