C12H13Cl2NS — CID 115642880
N-[(2,3-dichlorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 115642880) has the molecular formula C12H13Cl2NS and a molecular weight of 274.22 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(2,3-dichlorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 115642880 |
| Molecular Formula | C12H13Cl2NS |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | N-[(2,3-dichlorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H13Cl2NS/c1-2-7-16-8-6-15-9-10-4-3-5-11(13)12(10)14/h1,3-5,15H,6-9H2 |
| InChIKey | FWXARIFVXDBBGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|