C12H13ClFNS — CID 115642911
N-[(4-chloro-3-fluorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 115642911) has the molecular formula C12H13ClFNS and a molecular weight of 257.76 g/mol. Its IUPAC name is N-[(4-chloro-3-fluorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[(4-chloro-3-fluorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 115642911 |
| Molecular Formula | C12H13ClFNS |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-[(4-chloro-3-fluorophenyl)methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H13ClFNS/c1-2-6-16-7-5-15-9-10-3-4-11(13)12(14)8-10/h1,3-4,8,15H,5-7,9H2 |
| InChIKey | VCXAPBAULYBEDV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|