C13H13F4NS — CID 103823533
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-prop-2-ynylsulfanylethanamine (PubChem CID 103823533) has the molecular formula C13H13F4NS and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-prop-2-ynylsulfanylethanamine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-prop-2-ynylsulfanylethanamine |
|---|---|
| PubChem CID | 103823533 |
| Molecular Formula | C13H13F4NS |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-prop-2-ynylsulfanylethanamine |
| SMILES | C#CCSCCNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F4NS/c1-2-4-19-5-3-18-9-10-6-11(13(15,16)17)8-12(14)7-10/h1,6-8,18H,3-5,9H2 |
| InChIKey | DEOMBFDSQAJOGZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|