C11H12F4N2O — CID 115350323
3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanamide (PubChem CID 115350323) has the molecular formula C11H12F4N2O and a molecular weight of 264.22 g/mol. Its IUPAC name is 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanamide.
| Compound Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 115350323 |
| Molecular Formula | C11H12F4N2O |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-[[3-fluoro-5-(trifluoromethyl)phenyl]methylamino]propanamide |
| SMILES | NC(=O)CCNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F4N2O/c12-9-4-7(6-17-2-1-10(16)18)3-8(5-9)11(13,14)15/h3-5,17H,1-2,6H2,(H2,16,18) |
| InChIKey | RQIJNCYJWRLHBV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|