C12H11F6NO2 — CID 18426652
3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]propanoic acid (PubChem CID 18426652) has the molecular formula C12H11F6NO2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 18426652 |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F6NO2/c13-11(14,15)8-3-7(6-19-2-1-10(20)21)4-9(5-8)12(16,17)18/h3-5,19H,1-2,6H2,(H,20,21) |
| InChIKey | NHFNQNROTZRAEM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|