C13H12F6N2O2 — CID 143135379
N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]butanediamide (PubChem CID 143135379) has the molecular formula C13H12F6N2O2 and a molecular weight of 342.24 g/mol. Its IUPAC name is N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]butanediamide.
| Compound Name | N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]butanediamide |
|---|---|
| PubChem CID | 143135379 |
| Molecular Formula | C13H12F6N2O2 |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]butanediamide |
| SMILES | NC(=O)CCC(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F6N2O2/c14-12(15,16)8-3-7(4-9(5-8)13(17,18)19)6-21-11(23)2-1-10(20)22/h3-5H,1-2,6H2,(H2,20,22)(H,21,23) |
| InChIKey | JCUTYJKQZYQJBN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |