C11H10F6N2O2 — CID 166182708
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methoxyurea (PubChem CID 166182708) has the molecular formula C11H10F6N2O2 and a molecular weight of 316.20 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methoxyurea.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methoxyurea |
|---|---|
| PubChem CID | 166182708 |
| Molecular Formula | C11H10F6N2O2 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-methoxyurea |
| SMILES | CONC(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6N2O2/c1-21-19-9(20)18-5-6-2-7(10(12,13)14)4-8(3-6)11(15,16)17/h2-4H,5H2,1H3,(H2,18,19,20) |
| InChIKey | KYRNSVPCRPIQCS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|