C17H14F6N2O2 — CID 3809649
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 3809649) has the molecular formula C17H14F6N2O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 3809649 |
| Molecular Formula | C17H14F6N2O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | COc1cccc(CNC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C17H14F6N2O2/c1-27-14-4-2-3-10(5-14)9-24-15(26)25-13-7-11(16(18,19)20)6-12(8-13)17(21,22)23/h2-8H,9H2,1H3,(H2,24,25,26) |
| InChIKey | ULCSVPNTVXNEED-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |