C16H12F6N2O — CID 45112292
1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]urea (PubChem CID 45112292) has the molecular formula C16H12F6N2O and a molecular weight of 362.27 g/mol. Its IUPAC name is 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]urea.
| Compound Name | 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 45112292 |
| Molecular Formula | C16H12F6N2O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 1-benzyl-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12F6N2O/c17-15(18,19)11-6-12(16(20,21)22)8-13(7-11)24-14(25)23-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,23,24,25) |
| InChIKey | BMMSQIFLQUZARG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |