C17H16F4N2OS — CID 166650200
1-[(4-ethylsulfanylphenyl)methyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 166650200) has the molecular formula C17H16F4N2OS and a molecular weight of 372.39 g/mol. Its IUPAC name is 1-[(4-ethylsulfanylphenyl)methyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(4-ethylsulfanylphenyl)methyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166650200 |
| Molecular Formula | C17H16F4N2OS |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[(4-ethylsulfanylphenyl)methyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | CCSc1ccc(CNC(=O)Nc2cc(F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H16F4N2OS/c1-2-25-15-5-3-11(4-6-15)10-22-16(24)23-14-8-12(17(19,20)21)7-13(18)9-14/h3-9H,2,10H2,1H3,(H2,22,23,24) |
| InChIKey | CKDGKXZCXDUARQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |