C16H15F3N2OS2 — CID 3451199
1-[(4-methylsulfanylphenyl)methyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 3451199) has the molecular formula C16H15F3N2OS2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 1-[(4-methylsulfanylphenyl)methyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[(4-methylsulfanylphenyl)methyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 3451199 |
| Molecular Formula | C16H15F3N2OS2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 1-[(4-methylsulfanylphenyl)methyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | CSc1ccc(CNC(=O)Nc2cccc(SC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H15F3N2OS2/c1-23-13-7-5-11(6-8-13)10-20-15(22)21-12-3-2-4-14(9-12)24-16(17,18)19/h2-9H,10H2,1H3,(H2,20,21,22) |
| InChIKey | WVNHRLSLQAZAJZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |