C15H15ClN2OS — CID 17087557
1-[(4-chlorophenyl)methyl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 17087557) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 17087557 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H15ClN2OS/c1-20-14-4-2-3-13(9-14)18-15(19)17-10-11-5-7-12(16)8-6-11/h2-9H,10H2,1H3,(H2,17,18,19) |
| InChIKey | BQVMAOOLYJZZII-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |