C14H16N2OS2 — CID 47031902
1-(3-methylsulfanylphenyl)-3-[(3-methylthiophen-2-yl)methyl]urea (PubChem CID 47031902) has the molecular formula C14H16N2OS2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-(3-methylsulfanylphenyl)-3-[(3-methylthiophen-2-yl)methyl]urea.
| Compound Name | 1-(3-methylsulfanylphenyl)-3-[(3-methylthiophen-2-yl)methyl]urea |
|---|---|
| PubChem CID | 47031902 |
| Molecular Formula | C14H16N2OS2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(3-methylsulfanylphenyl)-3-[(3-methylthiophen-2-yl)methyl]urea |
| SMILES | CSc1cccc(NC(=O)NCc2sccc2C)c1 |
| InChI | InChI=1S/C14H16N2OS2/c1-10-6-7-19-13(10)9-15-14(17)16-11-4-3-5-12(8-11)18-2/h3-8H,9H2,1-2H3,(H2,15,16,17) |
| InChIKey | CGMQVZFWXHTQGA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |