C14H17F3N2O3S — CID 3799100
ethyl 4-[[3-(trifluoromethylsulfanyl)phenyl]carbamoylamino]butanoate (PubChem CID 3799100) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is ethyl 4-[[3-(trifluoromethylsulfanyl)phenyl]carbamoylamino]butanoate.
| Compound Name | ethyl 4-[[3-(trifluoromethylsulfanyl)phenyl]carbamoylamino]butanoate |
|---|---|
| PubChem CID | 3799100 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | ethyl 4-[[3-(trifluoromethylsulfanyl)phenyl]carbamoylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O3S/c1-2-22-12(20)7-4-8-18-13(21)19-10-5-3-6-11(9-10)23-14(15,16)17/h3,5-6,9H,2,4,7-8H2,1H3,(H2,18,19,21) |
| InChIKey | NJFASHQICZYKCO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|