C14H20N2O3S — CID 3705262
ethyl 4-[(4-methylsulfanylphenyl)carbamoylamino]butanoate (PubChem CID 3705262) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is ethyl 4-[(4-methylsulfanylphenyl)carbamoylamino]butanoate.
| Compound Name | ethyl 4-[(4-methylsulfanylphenyl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 3705262 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | ethyl 4-[(4-methylsulfanylphenyl)carbamoylamino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)Nc1ccc(SC)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-3-19-13(17)5-4-10-15-14(18)16-11-6-8-12(20-2)9-7-11/h6-9H,3-5,10H2,1-2H3,(H2,15,16,18) |
| InChIKey | MHHHOJOFFHZJNM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|