C12H15F3N2O3S — CID 3471027
1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 3471027) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 3471027 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | COC(CNC(=O)Nc1cccc(SC(F)(F)F)c1)OC |
| InChI | InChI=1S/C12H15F3N2O3S/c1-19-10(20-2)7-16-11(18)17-8-4-3-5-9(6-8)21-12(13,14)15/h3-6,10H,7H2,1-2H3,(H2,16,17,18) |
| InChIKey | QOXNBFVOJWBUFT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|