C14H9BrClF3N2OS — CID 175721835
1-(3-bromo-5-chlorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 175721835) has the molecular formula C14H9BrClF3N2OS and a molecular weight of 425.66 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 175721835 |
| Molecular Formula | C14H9BrClF3N2OS |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 423.93 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1cc(Cl)cc(Br)c1)Nc1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H9BrClF3N2OS/c15-8-4-9(16)6-11(5-8)21-13(22)20-10-2-1-3-12(7-10)23-14(17,18)19/h1-7H,(H2,20,21,22) |
| InChIKey | YKZDJAKVOUYKNT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |