C15H12BrF3N2O2S — CID 166747597
1-[5-bromo-2-(hydroxymethyl)phenyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 166747597) has the molecular formula C15H12BrF3N2O2S and a molecular weight of 421.24 g/mol. Its IUPAC name is 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 166747597 |
| Molecular Formula | C15H12BrF3N2O2S |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-[3-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(SC(F)(F)F)c1)Nc1cc(Br)ccc1CO |
| InChI | InChI=1S/C15H12BrF3N2O2S/c16-10-5-4-9(8-22)13(6-10)21-14(23)20-11-2-1-3-12(7-11)24-15(17,18)19/h1-7,22H,8H2,(H2,20,21,23) |
| InChIKey | ZJCYEWPSJRVUGH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |