C13H11BrFN3O2 — CID 156854469
1-[5-bromo-2-(hydroxymethyl)phenyl]-3-(2-fluoro-4-pyridinyl)urea (PubChem CID 156854469) has the molecular formula C13H11BrFN3O2 and a molecular weight of 340.15 g/mol. Its IUPAC name is 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-(2-fluoro-4-pyridinyl)urea.
| Compound Name | 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-(2-fluoro-4-pyridinyl)urea |
|---|---|
| PubChem CID | 156854469 |
| Molecular Formula | C13H11BrFN3O2 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 1-[5-bromo-2-(hydroxymethyl)phenyl]-3-(2-fluoro-4-pyridinyl)urea |
| SMILES | O=C(Nc1ccnc(F)c1)Nc1cc(Br)ccc1CO |
| InChI | InChI=1S/C13H11BrFN3O2/c14-9-2-1-8(7-19)11(5-9)18-13(20)17-10-3-4-16-12(15)6-10/h1-6,19H,7H2,(H2,16,17,18,20) |
| InChIKey | WCBWIPIIZZIZBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|