C12H10BrFN4O2 — CID 155390784
1-(2-bromo-4-pyridinyl)-3-[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]urea (PubChem CID 155390784) has the molecular formula C12H10BrFN4O2 and a molecular weight of 341.14 g/mol. Its IUPAC name is 1-(2-bromo-4-pyridinyl)-3-[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]urea.
| Compound Name | 1-(2-bromo-4-pyridinyl)-3-[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]urea |
|---|---|
| PubChem CID | 155390784 |
| Molecular Formula | C12H10BrFN4O2 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-(2-bromo-4-pyridinyl)-3-[2-fluoro-5-(hydroxymethyl)-4-pyridinyl]urea |
| SMILES | O=C(Nc1ccnc(Br)c1)Nc1cc(F)ncc1CO |
| InChI | InChI=1S/C12H10BrFN4O2/c13-10-3-8(1-2-15-10)17-12(20)18-9-4-11(14)16-5-7(9)6-19/h1-5,19H,6H2,(H2,15,16,17,18,20) |
| InChIKey | UTUUCWUQRIWRSD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|