C11H9F3N4O2S — CID 158418958
1-[3-deuterio-2-fluoro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea (PubChem CID 158418958) has the molecular formula C11H9F3N4O2S and a molecular weight of 319.29 g/mol. Its IUPAC name is 1-[3-deuterio-2-fluoro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea.
| Compound Name | 1-[3-deuterio-2-fluoro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea |
|---|---|
| PubChem CID | 158418958 |
| Molecular Formula | C11H9F3N4O2S |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 1-[3-deuterio-2-fluoro-5-(hydroxymethyl)-4-pyridinyl]-3-[3-(difluoromethyl)-1,2-thiazol-5-yl]urea |
| SMILES | [2H]c1c(F)ncc(CO)c1NC(=O)Nc1cc(C(F)F)ns1 |
| InChI | InChI=1S/C11H9F3N4O2S/c12-8-1-6(5(4-19)3-15-8)16-11(20)17-9-2-7(10(13)14)18-21-9/h1-3,10,19H,4H2,(H2,15,16,17,20)/i1D |
| InChIKey | CKYCAIAVJIFWPE-MICDWDOJSA-N |
| XLogP | 2.75 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|