C14H14N4OS — CID 91286178
1-(1-methylindol-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea (PubChem CID 91286178) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is 1-(1-methylindol-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea.
| Compound Name | 1-(1-methylindol-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea |
|---|---|
| PubChem CID | 91286178 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 1-(1-methylindol-3-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cn(C)c3ccccc23)sn1 |
| InChI | InChI=1S/C14H14N4OS/c1-9-7-13(20-17-9)16-14(19)15-11-8-18(2)12-6-4-3-5-10(11)12/h3-8H,1-2H3,(H2,15,16,19) |
| InChIKey | SZYIWSKSYZPTHG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |