C16H23N3O — CID 40519468
3-(1-methylindol-3-yl)-1,1-dipropylurea (PubChem CID 40519468) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-1,1-dipropylurea.
| Compound Name | 3-(1-methylindol-3-yl)-1,1-dipropylurea |
|---|---|
| PubChem CID | 40519468 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 3-(1-methylindol-3-yl)-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)Nc1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H23N3O/c1-4-10-19(11-5-2)16(20)17-14-12-18(3)15-9-7-6-8-13(14)15/h6-9,12H,4-5,10-11H2,1-3H3,(H,17,20) |
| InChIKey | BDLGXRNDPMMTER-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |