C16H22N2O — CID 110762474
1-methyl-N,N-dipropylindole-3-carboxamide (PubChem CID 110762474) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-methyl-N,N-dipropylindole-3-carboxamide.
| Compound Name | 1-methyl-N,N-dipropylindole-3-carboxamide |
|---|---|
| PubChem CID | 110762474 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-methyl-N,N-dipropylindole-3-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C16H22N2O/c1-4-10-18(11-5-2)16(19)14-12-17(3)15-9-7-6-8-13(14)15/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | BAFDTXFCKKTMLE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |