C14H14N2O5 — CID 63650839
2-[carboxymethyl-(1-methylindole-3-carbonyl)amino]acetic acid (PubChem CID 63650839) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-[carboxymethyl-(1-methylindole-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl-(1-methylindole-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 63650839 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[carboxymethyl-(1-methylindole-3-carbonyl)amino]acetic acid |
| SMILES | Cn1cc(C(=O)N(CC(=O)O)CC(=O)O)c2ccccc21 |
| InChI | InChI=1S/C14H14N2O5/c1-15-6-10(9-4-2-3-5-11(9)15)14(21)16(7-12(17)18)8-13(19)20/h2-6H,7-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | CBLICDWHRBNLKS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |