ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid

C13H15NO3 — CID 91016552

IUPACethane;2-(1-methylindol-3-yl)-2-oxoacetic acid
SMILESCC.Cn1cc(C(=O)C(=O)O)c2ccccc21
InChIInChI=1S/C11H9NO3.C2H6/c1-12-6-8(10(13)11(14)15)7-4-2-3-5-9(7)12;1-2/h2-6H,1H3,(H,14,15);1-2H3
InChIKeyDAHJNOKYHDIFNM-UHFFFAOYSA-N
MW233.27 g/mol
LogP2.47
Rot. Bonds2

About ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid

ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid (PubChem CID 91016552) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid.

Molecular Properties

Compound Nameethane;2-(1-methylindol-3-yl)-2-oxoacetic acid
PubChem CID91016552
Molecular FormulaC13H15NO3
Molecular Weight233.27 g/mol
Exact Mass233.11
IUPAC Nameethane;2-(1-methylindol-3-yl)-2-oxoacetic acid
SMILESCC.Cn1cc(C(=O)C(=O)O)c2ccccc21
InChIInChI=1S/C11H9NO3.C2H6/c1-12-6-8(10(13)11(14)15)7-4-2-3-5-9(7)12;1-2/h2-6H,1H3,(H,14,15);1-2H3
InChIKeyDAHJNOKYHDIFNM-UHFFFAOYSA-N
XLogP2.47
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.27
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid?
The IUPAC name of ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid (CID 91016552) is ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid.
What is the SMILES notation for ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid?
The canonical SMILES for ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid is CC.Cn1cc(C(=O)C(=O)O)c2ccccc21.
What is the InChIKey of ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid?
The InChIKey is DAHJNOKYHDIFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO3.C2H6/c1-12-6-8(10(13)11(14)15)7-4-2-3-5-9(7)12;1-2/h2-6H,1H3,(H,14,15);1-2H3.
What are the key properties of ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid?
ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid has a molecular weight of 233.27 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(1-methylindol-3-yl)-2-oxoacetic acid is sourced from PubChem (CID 91016552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).