About N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide
N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide (PubChem CID 10542762) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide.
Molecular Properties
| Compound Name | N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide |
| PubChem CID | 10542762 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide |
| SMILES | CN(NC(=O)C(=O)c1cn(C)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C18H17N3O2/c1-20-12-15(14-10-6-7-11-16(14)20)17(22)18(23)19-21(2)13-8-4-3-5-9-13/h3-12H,1-2H3,(H,19,23) |
| InChIKey | WUOZCQQCPYAIOL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide?
The IUPAC name of N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide (CID 10542762) is N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide.
What is the SMILES notation for N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide?
The canonical SMILES for N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide is CN(NC(=O)C(=O)c1cn(C)c2ccccc12)c1ccccc1.
What is the InChIKey of N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide?
The InChIKey is WUOZCQQCPYAIOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-20-12-15(14-10-6-7-11-16(14)20)17(22)18(23)19-21(2)13-8-4-3-5-9-13/h3-12H,1-2H3,(H,19,23).
What are the key properties of N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide?
N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide has a molecular weight of 307.35 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-2-(1-methylindol-3-yl)-2-oxo-N'-phenylacetohydrazide is sourced from PubChem (CID 10542762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).