C19H29N3O — CID 40519593
3-(1-ethylindol-3-yl)-1,1-bis(2-methylpropyl)urea (PubChem CID 40519593) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-(1-ethylindol-3-yl)-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-(1-ethylindol-3-yl)-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 40519593 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | 3-(1-ethylindol-3-yl)-1,1-bis(2-methylpropyl)urea |
| SMILES | CCn1cc(NC(=O)N(CC(C)C)CC(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H29N3O/c1-6-21-13-17(16-9-7-8-10-18(16)21)20-19(23)22(11-14(2)3)12-15(4)5/h7-10,13-15H,6,11-12H2,1-5H3,(H,20,23) |
| InChIKey | ILJMZQJXCAKOBM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |