C15H23IN2O — CID 47258185
3-(2-iodophenyl)-1,1-bis(2-methylpropyl)urea (PubChem CID 47258185) has the molecular formula C15H23IN2O and a molecular weight of 374.27 g/mol. Its IUPAC name is 3-(2-iodophenyl)-1,1-bis(2-methylpropyl)urea.
| Compound Name | 3-(2-iodophenyl)-1,1-bis(2-methylpropyl)urea |
|---|---|
| PubChem CID | 47258185 |
| Molecular Formula | C15H23IN2O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-(2-iodophenyl)-1,1-bis(2-methylpropyl)urea |
| SMILES | CC(C)CN(CC(C)C)C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C15H23IN2O/c1-11(2)9-18(10-12(3)4)15(19)17-14-8-6-5-7-13(14)16/h5-8,11-12H,9-10H2,1-4H3,(H,17,19) |
| InChIKey | KVKMVDJKLRQDNF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|