C13H19IN2O — CID 43113743
N,N-diethyl-2-(2-iodoanilino)propanamide (PubChem CID 43113743) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is N,N-diethyl-2-(2-iodoanilino)propanamide.
| Compound Name | N,N-diethyl-2-(2-iodoanilino)propanamide |
|---|---|
| PubChem CID | 43113743 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | N,N-diethyl-2-(2-iodoanilino)propanamide |
| SMILES | CCN(CC)C(=O)C(C)Nc1ccccc1I |
| InChI | InChI=1S/C13H19IN2O/c1-4-16(5-2)13(17)10(3)15-12-9-7-6-8-11(12)14/h6-10,15H,4-5H2,1-3H3 |
| InChIKey | UGZCKFALBJCJMM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|