C20H21N3O — CID 40519696
(2S)-N-(1-ethylindol-3-yl)-2-methyl-2,3-dihydroindole-1-carboxamide (PubChem CID 40519696) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (2S)-N-(1-ethylindol-3-yl)-2-methyl-2,3-dihydroindole-1-carboxamide.
| Compound Name | (2S)-N-(1-ethylindol-3-yl)-2-methyl-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 40519696 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (2S)-N-(1-ethylindol-3-yl)-2-methyl-2,3-dihydroindole-1-carboxamide |
| SMILES | CCn1cc(NC(=O)N2c3ccccc3C[C@@H]2C)c2ccccc21 |
| InChI | InChI=1S/C20H21N3O/c1-3-22-13-17(16-9-5-7-11-19(16)22)21-20(24)23-14(2)12-15-8-4-6-10-18(15)23/h4-11,13-14H,3,12H2,1-2H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | QRXZUGSTBVEBSS-AWEZNQCLSA-N |
| XLogP | 4.64 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |