C22H28N2O4 — CID 108869872
2-methyl-N-(3,4,5-triethoxyphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 108869872) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-methyl-N-(3,4,5-triethoxyphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 2-methyl-N-(3,4,5-triethoxyphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 108869872 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-methyl-N-(3,4,5-triethoxyphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CCOc1cc(NC(=O)N2c3ccccc3CC2C)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H28N2O4/c1-5-26-19-13-17(14-20(27-6-2)21(19)28-7-3)23-22(25)24-15(4)12-16-10-8-9-11-18(16)24/h8-11,13-15H,5-7,12H2,1-4H3,(H,23,25) |
| InChIKey | HPFYARNAXGEXCP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |