C18H20N2OS — CID 7733596
(2S)-N-(4-ethoxyphenyl)-2-methyl-2,3-dihydroindole-1-carbothioamide (PubChem CID 7733596) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is (2S)-N-(4-ethoxyphenyl)-2-methyl-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2S)-N-(4-ethoxyphenyl)-2-methyl-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 7733596 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2S)-N-(4-ethoxyphenyl)-2-methyl-2,3-dihydroindole-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2c3ccccc3C[C@@H]2C)cc1 |
| InChI | InChI=1S/C18H20N2OS/c1-3-21-16-10-8-15(9-11-16)19-18(22)20-13(2)12-14-6-4-5-7-17(14)20/h4-11,13H,3,12H2,1-2H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | WXVWLXPREXKLLL-ZDUSSCGKSA-N |
| XLogP | 4.23 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|