C16H17N3O2S2 — CID 972032
(2S)-2-methyl-N-(4-sulfamoylphenyl)-2,3-dihydroindole-1-carbothioamide (PubChem CID 972032) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is (2S)-2-methyl-N-(4-sulfamoylphenyl)-2,3-dihydroindole-1-carbothioamide.
| Compound Name | (2S)-2-methyl-N-(4-sulfamoylphenyl)-2,3-dihydroindole-1-carbothioamide |
|---|---|
| PubChem CID | 972032 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | (2S)-2-methyl-N-(4-sulfamoylphenyl)-2,3-dihydroindole-1-carbothioamide |
| SMILES | C[C@H]1Cc2ccccc2N1C(=S)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-11-10-12-4-2-3-5-15(12)19(11)16(22)18-13-6-8-14(9-7-13)23(17,20)21/h2-9,11H,10H2,1H3,(H,18,22)(H2,17,20,21)/t11-/m0/s1 |
| InChIKey | XWNJBFOBUVISQU-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|