C26H25N3O7S2 — CID 2385382
[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-[4-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate (PubChem CID 2385382) has the molecular formula C26H25N3O7S2 and a molecular weight of 555.63 g/mol. Its IUPAC name is [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-[4-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-[4-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2385382 |
| Molecular Formula | C26H25N3O7S2 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.11 |
| IUPAC Name | [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-[4-[(4-sulfamoylphenyl)sulfamoyl]phenyl]prop-2-enoate |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)COC(=O)/C=C/c1ccc(S(=O)(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H25N3O7S2/c1-18-16-20-4-2-3-5-24(20)29(18)25(30)17-36-26(31)15-8-19-6-11-23(12-7-19)38(34,35)28-21-9-13-22(14-10-21)37(27,32)33/h2-15,18,28H,16-17H2,1H3,(H2,27,32,33)/b15-8+/t18-/m0/s1 |
| InChIKey | NYLCWEVWTNOQJC-KWJIGKFDSA-N |
| XLogP | 2.67 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|