C20H18ClNO3 — CID 7868061
[2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 7868061) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7868061 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [2-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)COC(=O)/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO3/c1-14-12-16-4-2-3-5-18(16)22(14)19(23)13-25-20(24)11-8-15-6-9-17(21)10-7-15/h2-11,14H,12-13H2,1H3/b11-8+/t14-/m1/s1 |
| InChIKey | SDLLHSKJXQDGPG-BMGYJQCNSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|