C20H17Cl2NO3 — CID 7874094
[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7874094) has the molecular formula C20H17Cl2NO3 and a molecular weight of 390.27 g/mol. Its IUPAC name is [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7874094 |
| Molecular Formula | C20H17Cl2NO3 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | [2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)COC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl2NO3/c1-13-10-15-4-2-3-5-18(15)23(13)19(24)12-26-20(25)9-7-14-6-8-16(21)11-17(14)22/h2-9,11,13H,10,12H2,1H3/b9-7+/t13-/m0/s1 |
| InChIKey | AJTKUBPOXVWTCT-XOVSCCBYSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|