C19H16Cl3NO4 — CID 23960161
[2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 23960161) has the molecular formula C19H16Cl3NO4 and a molecular weight of 428.70 g/mol. Its IUPAC name is [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23960161 |
| Molecular Formula | C19H16Cl3NO4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | [2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | CC1Cc2ccccc2N1C(=O)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl3NO4/c1-11-6-12-4-2-3-5-16(12)23(11)18(24)9-27-19(25)10-26-17-8-14(21)13(20)7-15(17)22/h2-5,7-8,11H,6,9-10H2,1H3 |
| InChIKey | KQWOKJYTYGIYOC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|