C20H20N2O2 — CID 46533623
N-[4-[(E)-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 46533623) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[4-[(E)-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46533623 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[4-[(E)-3-(2-methyl-2,3-dihydroindol-1-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/C(=O)N2c3ccccc3CC2C)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-14-13-17-5-3-4-6-19(17)22(14)20(24)12-9-16-7-10-18(11-8-16)21-15(2)23/h3-12,14H,13H2,1-2H3,(H,21,23)/b12-9+ |
| InChIKey | BUOMEKAKKSPLEE-FMIVXFBMSA-N |
| XLogP | 3.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|